What is the molecular formula of 2-tert-Butoxycarbonylamino-oxazole-5-carboxylic acid?
The molecular formula is C9H12N2O5.
What is the molecular weight of 2-tert-Butoxycarbonylamino-oxazole-5-carboxylic acid?
The molecular weight is 228.20 g/mol.
What are some synonyms for 2-tert-Butoxycarbonylamino-oxazole-5-carboxylic acid?
Some synonyms include 2-((tert-Butoxycarbonyl)amino)oxazole-5-carboxylic acid and 2-TERT-BUTOXYCARBONYLAMINO-OXAZOLE-5-CARBOXYLIC ACID.
When was 2-tert-Butoxycarbonylamino-oxazole-5-carboxylic acid created and last modified?
It was created on May 28, 2009, and last modified on December 30, 2023.
What is the InChI of 2-tert-Butoxycarbonylamino-oxazole-5-carboxylic acid?
The InChI is InChI=1S/C9H12N2O5/c1-9(2,3)16-8(14)11-7-10-4-5(15-7)6(12)13/h4H,1-3H3,(H,12,13)(H,10,11,14).
What is the Canonical SMILES of 2-tert-Butoxycarbonylamino-oxazole-5-carboxylic acid?
The Canonical SMILES is CC(C)(C)OC(=O)NC1=NC=C(O1)C(=O)O.
How many hydrogen bond donor counts does 2-tert-Butoxycarbonylamino-oxazole-5-carboxylic acid have?
It has 2 hydrogen bond donor counts.
What is the topological polar surface area of 2-tert-Butoxycarbonylamino-oxazole-5-carboxylic acid?
The topological polar surface area is 102?2.
How many rotatable bond counts does 2-tert-Butoxycarbonylamino-oxazole-5-carboxylic acid have?
It has 4 rotatable bond counts.
Is 2-tert-Butoxycarbonylamino-oxazole-5-carboxylic acid a canonicalized compound?
Yes, the compound is canonicalized.