903094-57-5 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C13H22N2O4.
The synonyms of the compound are 1-(1-TERT-BUTOXYCARBONYL-AZETIDIN-3-YL)-PYRROLIDINE-3-CARBOXYLIC ACID and 903094-68-8.
The molecular weight of the compound is 270.32 g/mol.
The IUPAC name of the compound is 1-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]pyrrolidine-3-carboxylic acid.
The InChI of the compound is InChI=1S/C13H22N2O4/c1-13(2,3)19-12(18)15-7-10(8-15)14-5-4-9(6-14)11(16)17/h9-10H,4-8H2,1-3H3,(H,16,17).
The InChIKey of the compound is BRPUZBGXSLNYIG-UHFFFAOYSA-N.
The canonical SMILES of the compound is CC(C)(C)OC(=O)N1CC(C1)N2CCC(C2)C(=O)O.
The XLogP3-AA value of the compound is -1.6.
The compound has 1 hydrogen bond donor count.
The compound has 5 hydrogen bond acceptor count.