903094-22-4 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is methyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-3-carboxylate.
The molecular formula of the compound is C12H22N2O4.
The molecular weight of the compound is 258.31 g/mol.
The InChI of the compound is InChI=1S/C12H22N2O4/c1-12(2,3)18-11(16)14-9-5-8(6-13-7-9)10(15)17-4/h8-9,13H,5-7H2,1-4H3,(H,14,16).
The InChIKey of the compound is NFLXTMHXWFFYGU-UHFFFAOYSA-N.
The canonical SMILES of the compound is CC(C)(C)OC(=O)NC1CC(CNC1)C(=O)OC.
The XLogP3-AA value of the compound is 0.6.
The compound has 2 hydrogen bond donor counts.
The compound has 5 hydrogen bond acceptor counts.
The compound has 5 rotatable bond counts.