5-Methoxypyrazine-2-carbaldehyde

• CAS: 32205-72-4
• Catalog Number: ACM32205724
• Category: Pyrazines
• Molecular Weight: 138.0
• Molecular Formula: C6H6N2O2
• Appearance: Yellow Powder

Custom Q&A

What is the molecular formula of 5-Methoxypyrazine-2-carbaldehyde?

The molecular formula is C6H6N2O2.

What is the molecular weight of 5-Methoxypyrazine-2-carbaldehyde?

The molecular weight is 138.12 g/mol.

What is the IUPAC name of 5-Methoxypyrazine-2-carbaldehyde?

The IUPAC name is 5-methoxypyrazine-2-carbaldehyde.

What is the InChI code of 5-Methoxypyrazine-2-carbaldehyde?

The InChI code is InChI=1S/C6H6N2O2/c1-10-6-3-7-5(4-9)2-8-6/h2-4H,1H3.

What is the InChIKey of 5-Methoxypyrazine-2-carbaldehyde?

The InChIKey is KSOOMHYFEFVYRI-UHFFFAOYSA-N.

What is the canonical SMILES of 5-Methoxypyrazine-2-carbaldehyde?

The canonical SMILES is COC1=NC=C(N=C1)C=O.

What is the CAS number of 5-Methoxypyrazine-2-carbaldehyde?

The CAS number is 32205-72-4.

What is the XLogP3 value of 5-Methoxypyrazine-2-carbaldehyde?

The XLogP3 value is 0.4.

How many hydrogen bond donor counts does 5-Methoxypyrazine-2-carbaldehyde have?

It has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 5-Methoxypyrazine-2-carbaldehyde have?

It has 4 hydrogen bond acceptor counts.