(3-amino-6-bromopyrazin-2-yl)methanol

• CAS: 1260880-59-8
• Catalog Number: ACM1260880598
• Category: Pyrazines
• Molecular Weight: 204.0
• Molecular Formula: C5H6BrN3O
• Appearance: Off-white Powder

Custom Q&A

What is the molecular formula of (3-amino-6-bromopyrazin-2-yl)methanol?

The molecular formula is C5H6BrN3O.

What is the molecular weight of (3-amino-6-bromopyrazin-2-yl)methanol?

The molecular weight is 204.02 g/mol.

What is the IUPAC name of (3-amino-6-bromopyrazin-2-yl)methanol?

The IUPAC name is (3-amino-6-bromopyrazin-2-yl)methanol.

What is the InChI of (3-amino-6-bromopyrazin-2-yl)methanol?

The InChI is InChI=1S/C5H6BrN3O/c6-4-1-8-5(7)3(2-10)9-4/h1,10H,2H2,(H2,7,8).

What is the InChIKey of (3-amino-6-bromopyrazin-2-yl)methanol?

The InChIKey is SWHROBJGQFGJRI-UHFFFAOYSA-N.

What is the canonical SMILES of (3-amino-6-bromopyrazin-2-yl)methanol?

The canonical SMILES is C1=C(N=C(C(=N1)N)CO)Br.

What is the CAS number of (3-amino-6-bromopyrazin-2-yl)methanol?

The CAS number is 1260880-59-8.

What is the XLogP3-AA value of (3-amino-6-bromopyrazin-2-yl)methanol?

The XLogP3-AA value is 0.2.

How many hydrogen bond donor counts are present in (3-amino-6-bromopyrazin-2-yl)methanol?

There are 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts are present in (3-amino-6-bromopyrazin-2-yl)methanol?

There are 4 hydrogen bond acceptor counts.