What is the molecular formula of 5-Isopropyl-4-methoxy-2-methylbenzaldehyde?
The molecular formula is C12H16O2.
What is the molecular weight of 5-Isopropyl-4-methoxy-2-methylbenzaldehyde?
The molecular weight is 192.25 g/mol.
What is the IUPAC name of 5-Isopropyl-4-methoxy-2-methylbenzaldehyde?
The IUPAC name is 4-methoxy-2-methyl-5-propan-2-ylbenzaldehyde.
What is the InChI of 5-Isopropyl-4-methoxy-2-methylbenzaldehyde?
The InChI is InChI=1S/C12H16O2/c1-8(2)11-6-10(7-13)9(3)5-12(11)14-4/h5-8H,1-4H3.
What is the InChIKey of 5-Isopropyl-4-methoxy-2-methylbenzaldehyde?
The InChIKey is UREBGRBNUQCTAF-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Isopropyl-4-methoxy-2-methylbenzaldehyde?
The canonical SMILES is CC1=CC(=C(C=C1C=O)C(C)C)OC.
What is the CAS number of 5-Isopropyl-4-methoxy-2-methylbenzaldehyde?
The CAS number is 105337-42-6.
What is the EC number of 5-Isopropyl-4-methoxy-2-methylbenzaldehyde?
The EC number is 804-807-6.
What is the XLogP3-AA value of 5-Isopropyl-4-methoxy-2-methylbenzaldehyde?
The XLogP3-AA value is 2.8.
Is 5-Isopropyl-4-methoxy-2-methylbenzaldehyde a canonicalized compound according to PubChem?
Yes, it is a canonicalized compound according to PubChem.