N-(2,4-Dimethoxyphenyl)-3-oxobutanamide

• Catalog Number: ACMA00002252
• Category: Ethers
• Molecular Weight: 237.25
• Molecular Formula: C₁₂H₁₄O₅
• Hazard Statements: H301
• RIDADR: NONH for all modes of transport
• Symbol: GHS06

Custom Q&A

What is the molecular formula of N-(2,4-Dimethoxyphenyl)-3-oxobutanamide?

The molecular formula is C12H15NO4.

What is the molecular weight of N-(2,4-Dimethoxyphenyl)-3-oxobutanamide?

The molecular weight is 237.25 g/mol.

What is the IUPAC name of N-(2,4-Dimethoxyphenyl)-3-oxobutanamide?

The IUPAC name is N-(2,4-dimethoxyphenyl)-3-oxobutanamide.

What are the synonyms of N-(2,4-Dimethoxyphenyl)-3-oxobutanamide?

The synonyms are 2',4'-Dimethoxyacetoacetanilide and Butanamide, N-(2,4-dimethoxyphenyl)-3-oxo-.

What is the InChI code for N-(2,4-Dimethoxyphenyl)-3-oxobutanamide?

The InChI code is InChI=1S/C12H15NO4/c1-8(14)6-12(15)13-10-5-4-9(16-2)7-11(10)17-3/h4-5,7H,6H2,1-3H3,(H,13,15).

What is the InChIKey for N-(2,4-Dimethoxyphenyl)-3-oxobutanamide?

The InChIKey is IQWUCASGTZCNKK-UHFFFAOYSA-N.

What is the canonical SMILES for N-(2,4-Dimethoxyphenyl)-3-oxobutanamide?

The canonical SMILES is CC(=O)CC(=O)NC1=C(C=C(C=C1)OC)OC.

What is the CAS number of N-(2,4-Dimethoxyphenyl)-3-oxobutanamide?

The CAS number is 16715-79-0.

What is the XLogP3 value of N-(2,4-Dimethoxyphenyl)-3-oxobutanamide?

The XLogP3 value is 1.7.

How many hydrogen bond acceptors does N-(2,4-Dimethoxyphenyl)-3-oxobutanamide have?

It has 4 hydrogen bond acceptors.