2-(4-Isopropylphenoxy)propanoic acid

• Catalog Number: ACMA00002247
• Category: Ethers
• Molecular Weight: 208.25
• Molecular Formula: C₁₂H₁₅NO₅S
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C12H16O3.

What are the synonyms of the compound?

The synonyms of the compound are 2-(4-isopropylphenoxy)propanoic acid, 237412-04-3, and 2-(4-propan-2-ylphenoxy)propanoic Acid.

What is the molecular weight of the compound?

The molecular weight of the compound is 208.25 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 2-(4-propan-2-ylphenoxy)propanoic acid.

What is the InChI code of the compound?

The InChI code of the compound is InChI=1S/C12H16O3/c1-8(2)10-4-6-11(7-5-10)15-9(3)12(13)14/h4-9H,1-3H3,(H,13,14).

What is the InChIKey of the compound?

The InChIKey of the compound is JQGMFMWLOKZVBQ-UHFFFAOYSA-N.

What is the canonical SMILES representation of the compound?

The canonical SMILES representation of the compound is CC(C)C1=CC=C(C=C1)OC(C)C(=O)O.

What is the CAS number of the compound?

The CAS number of the compound is 237412-04-3.

What is the XLogP3 value of the compound?

The XLogP3 value of the compound is 2.8.

Is the compound canonicalized?

Yes, the compound is canonicalized.