1451392-03-2 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 5-Formyl-2-ethoxyphenylboronic acid is C9H11BO4.
The molecular weight of 5-Formyl-2-ethoxyphenylboronic acid is 193.99 g/mol.
The IUPAC name of 5-Formyl-2-ethoxyphenylboronic acid is (2-ethoxy-5-formylphenyl)boronic acid.
The InChI code for 5-Formyl-2-ethoxyphenylboronic acid is InChI=1S/C9H11BO4/c1-2-14-9-4-3-7(6-11)5-8(9)10(12)13/h3-6,12-13H,2H2,1H3.
The InChIKey for 5-Formyl-2-ethoxyphenylboronic acid is AKDKQQWBMKEDLW-UHFFFAOYSA-N.
The canonical SMILES representation of 5-Formyl-2-ethoxyphenylboronic acid is B(C1=C(C=CC(=C1)C=O)OCC)(O)O.
The CAS number of 5-Formyl-2-ethoxyphenylboronic acid is 1003042-92-9.
The hydrogen bond donor count of 5-Formyl-2-ethoxyphenylboronic acid is 2.
The hydrogen bond acceptor count of 5-Formyl-2-ethoxyphenylboronic acid is 4.
Yes, 5-Formyl-2-ethoxyphenylboronic acid is a canonicalized compound.