CAS
1003042-92-9 Purity
96%
1003042-92-9 Purity
96%
Inquiry Basket
5-Formyl-3-methoxyphenylboronic acid
CAS
1451392-09-8
Catalog Number
ACM1451392098
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 5-Formyl-3-methoxyphenylboronic acid?
The molecular formula of 5-Formyl-3-methoxyphenylboronic acid is C8H9BO4.
What are the synonyms for 5-Formyl-3-methoxyphenylboronic acid?
Some synonyms for 5-Formyl-3-methoxyphenylboronic acid are (3-formyl-5-methoxyphenyl)boronic acid and BIC39209.
What is the molecular weight of 5-Formyl-3-methoxyphenylboronic acid?
The molecular weight of 5-Formyl-3-methoxyphenylboronic acid is 179.97 g/mol.
When was 5-Formyl-3-methoxyphenylboronic acid created?
5-Formyl-3-methoxyphenylboronic acid was created on August 8, 2012.
What is the IUPAC name of 5-Formyl-3-methoxyphenylboronic acid?
The IUPAC name of 5-Formyl-3-methoxyphenylboronic acid is (3-formyl-5-methoxyphenyl)boronic acid.
What is the InChI of 5-Formyl-3-methoxyphenylboronic acid?
The InChI of 5-Formyl-3-methoxyphenylboronic acid is InChI=1S/C8H9BO4/c1-13-8-3-6(5-10)2-7(4-8)9(11)12/h2-5,11-12H,1H3.
What is the InChIKey of 5-Formyl-3-methoxyphenylboronic acid?
The InChIKey of 5-Formyl-3-methoxyphenylboronic acid is BQBPIMVLGXGJIY-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Formyl-3-methoxyphenylboronic acid?
The canonical SMILES of 5-Formyl-3-methoxyphenylboronic acid is B(C1=CC(=CC(=C1)OC)C=O)(O)O.
What is the hydrogen bond donor count of 5-Formyl-3-methoxyphenylboronic acid?
The hydrogen bond donor count of 5-Formyl-3-methoxyphenylboronic acid is 2.
What is the hydrogen bond acceptor count of 5-Formyl-3-methoxyphenylboronic acid?
The hydrogen bond acceptor count of 5-Formyl-3-methoxyphenylboronic acid is 4.
Recommended Products
