1451391-99-3 Purity
---
If you have any other questions or need other size, please get a quote.
The molecular formula of 3-Fluoro-2-formyl-4-methoxyphenylboronic acid is C8H8BFO4.
The molecular weight of 3-Fluoro-2-formyl-4-methoxyphenylboronic acid is 197.96 g/mol.
The IUPAC name of 3-Fluoro-2-formyl-4-methoxyphenylboronic acid is (3-fluoro-2-formyl-4-methoxyphenyl)boronic acid.
The InChI of 3-Fluoro-2-formyl-4-methoxyphenylboronic acid is InChI=1S/C8H8BFO4/c1-14-7-3-2-6(9(12)13)5(4-11)8(7)10/h2-4,12-13H,1H3.
The InChIKey of 3-Fluoro-2-formyl-4-methoxyphenylboronic acid is UJXWHOFERMURPA-UHFFFAOYSA-N.
The canonical SMILES of 3-Fluoro-2-formyl-4-methoxyphenylboronic acid is B(C1=C(C(=C(C=C1)OC)F)C=O)(O)O.
The CAS number of 3-Fluoro-2-formyl-4-methoxyphenylboronic acid is 1451392-03-2.
The hydrogen bond donor count of 3-Fluoro-2-formyl-4-methoxyphenylboronic acid is 2.
The hydrogen bond acceptor count of 3-Fluoro-2-formyl-4-methoxyphenylboronic acid is 5.
The topological polar surface area of 3-Fluoro-2-formyl-4-methoxyphenylboronic acid is 66.8Ų.