5-Bromo-4,4,5,5-tetrafluoropentanoic acid

• Catalog Number: ACMA00001497
• Category: Amines
• Molecular Weight: 252.99
• Hazard Statements: H302-H314
• RIDADR: NONH for all modes of transport
• Symbol: GHS05

Custom Q&A

What is the molecular formula of 5-Bromo-4,4,5,5-tetrafluoropentanoic acid?

The molecular formula of 5-Bromo-4,4,5,5-tetrafluoropentanoic acid is C5H5BrF4O2.

What is the molecular weight of 5-Bromo-4,4,5,5-tetrafluoropentanoic acid?

The molecular weight of 5-Bromo-4,4,5,5-tetrafluoropentanoic acid is 252.99 g/mol.

What is the IUPAC name of 5-Bromo-4,4,5,5-tetrafluoropentanoic acid?

The IUPAC name of 5-Bromo-4,4,5,5-tetrafluoropentanoic acid is 5-bromo-4,4,5,5-tetrafluoropentanoic acid.

What is the InChI of 5-Bromo-4,4,5,5-tetrafluoropentanoic acid?

The InChI of 5-Bromo-4,4,5,5-tetrafluoropentanoic acid is InChI=1S/C5H5BrF4O2/c6-5(9,10)4(7,8)2-1-3(11)12/h1-2H2,(H,11,12).

What is the InChIKey of 5-Bromo-4,4,5,5-tetrafluoropentanoic acid?

The InChIKey of 5-Bromo-4,4,5,5-tetrafluoropentanoic acid is OIIFPRVLJLLMOZ-UHFFFAOYSA-N.

What is the canonical SMILES of 5-Bromo-4,4,5,5-tetrafluoropentanoic acid?

The canonical SMILES of 5-Bromo-4,4,5,5-tetrafluoropentanoic acid is C(CC(C(F)(F)Br)(F)F)C(=O)O.

What is the CAS number of 5-Bromo-4,4,5,5-tetrafluoropentanoic acid?

The CAS number of 5-Bromo-4,4,5,5-tetrafluoropentanoic acid is 234443-22-2.

How many hydrogen bond donor counts does 5-Bromo-4,4,5,5-tetrafluoropentanoic acid have?

5-Bromo-4,4,5,5-tetrafluoropentanoic acid has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does 5-Bromo-4,4,5,5-tetrafluoropentanoic acid have?

5-Bromo-4,4,5,5-tetrafluoropentanoic acid has 6 hydrogen bond acceptor counts.

How many rotatable bond counts does 5-Bromo-4,4,5,5-tetrafluoropentanoic acid have?

5-Bromo-4,4,5,5-tetrafluoropentanoic acid has 4 rotatable bond counts.