5-Bromo-2-methoxyacetophenone

• Catalog Number: ACMA00002933
• Category: Ethers
• Molecular Weight: 229.07
• Molecular Formula: C₉H₈O₄
• Hazard Statements: H302-H412
• RIDADR: UN 2811 6.1 / PGIII
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 5-Bromo-2-methoxyacetophenone?

The molecular formula is C9H9BrO2.

What is the molecular weight of 5-Bromo-2-methoxyacetophenone?

The molecular weight is 229.07 g/mol.

What is the IUPAC name of 5-Bromo-2-methoxyacetophenone?

The IUPAC name is 1-(5-bromo-2-methoxyphenyl)ethanone.

What is the InChI of 5-Bromo-2-methoxyacetophenone?

The InChI is InChI=1S/C9H9BrO2/c1-6(11)8-5-7(10)3-4-9(8)12-2/h3-5H,1-2H3.

What is the InChIKey of 5-Bromo-2-methoxyacetophenone?

The InChIKey is GLKBPFOSTPLEKE-UHFFFAOYSA-N.

What is the canonical SMILES of 5-Bromo-2-methoxyacetophenone?

The canonical SMILES is CC(=O)C1=C(C=CC(=C1)Br)OC.

What is the CAS number of 5-Bromo-2-methoxyacetophenone?

The CAS number is 16740-73-1.

What is the XLogP3 value of 5-Bromo-2-methoxyacetophenone?

The XLogP3 value is 2.5.

What is the hydrogen bond donor count of 5-Bromo-2-methoxyacetophenone?

The hydrogen bond donor count is 0.

Is 5-Bromo-2-methoxyacetophenone a canonical compound?

Yes, it is a canonical compound.