CAS
--- Purity
---
--- Purity
---
Inquiry Basket
(5-Bromo-2-methoxyphenyl)acetic acid
Catalog Number
ACMA00002932
Category
Ethers
Molecular Weight
245.07
Molecular Formula
C9H8O4
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H302
RIDADR
NONH for all modes of transport
Symbol
GHS07
What is the molecular formula of the compound?
The molecular formula of the compound is C9H9BrO3.
What are the synonyms for the compound?
The synonyms for the compound include 5-Bromo-2-methoxyphenylacetic acid, 7017-48-3, and (5-bromo-2-methoxyphenyl)acetic acid.
What is the molecular weight of the compound?
The molecular weight of the compound is 245.07 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 2-(5-bromo-2-methoxyphenyl)acetic acid.
What is the canonical SMILES notation for the compound?
The canonical SMILES notation for the compound is COC1=C(C=C(C=C1)Br)CC(=O)O.
How many hydrogen bond donor counts does the compound have?
The compound has 1 hydrogen bond donor count.
What is the topological polar surface area of the compound?
The topological polar surface area of the compound is 46.5Ų.
Does the compound have any defined atom stereocenters?
No, the compound does not have any defined atom stereocenters.
How many covalently-bonded unit counts does the compound have?
The compound has 1 covalently-bonded unit count.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
