3-Bromo-4-ethoxybenzoic acid

• Catalog Number: ACMA00002930
• Category: Ethers
• Molecular Weight: 245.07
• Molecular Formula: C₉H₈O₅
• Hazard Statements: H411
• RIDADR: NONH for all modes of transport
• Symbol: GHS09

Custom Q&A

What is the molecular formula of 3-Bromo-4-ethoxybenzoic acid?

The molecular formula of 3-Bromo-4-ethoxybenzoic acid is C9H9BrO3.

What is the molecular weight of 3-Bromo-4-ethoxybenzoic acid?

The molecular weight of 3-Bromo-4-ethoxybenzoic acid is 245.07 g/mol.

What is the IUPAC name of 3-Bromo-4-ethoxybenzoic acid?

The IUPAC name of 3-Bromo-4-ethoxybenzoic acid is 3-bromo-4-ethoxybenzoic acid.

What is the InChI of 3-Bromo-4-ethoxybenzoic acid?

The InChI of 3-Bromo-4-ethoxybenzoic acid is InChI=1S/C9H9BrO3/c1-2-13-8-4-3-6(9(11)12)5-7(8)10/h3-5H,2H2,1H3,(H,11,12).

What is the InChIKey of 3-Bromo-4-ethoxybenzoic acid?

The InChIKey of 3-Bromo-4-ethoxybenzoic acid is XCKMWULLKHQZIP-UHFFFAOYSA-N.

What is the canonical SMILES of 3-Bromo-4-ethoxybenzoic acid?

The canonical SMILES of 3-Bromo-4-ethoxybenzoic acid is CCOC1=C(C=C(C=C1)C(=O)O)Br.

What is the CAS number of 3-Bromo-4-ethoxybenzoic acid?

The CAS number of 3-Bromo-4-ethoxybenzoic acid is 24507-29-7.

What is the XLogP3 value of 3-Bromo-4-ethoxybenzoic acid?

The XLogP3 value of 3-Bromo-4-ethoxybenzoic acid is 2.7.

How many hydrogen bond donor counts does 3-Bromo-4-ethoxybenzoic acid have?

3-Bromo-4-ethoxybenzoic acid has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does 3-Bromo-4-ethoxybenzoic acid have?

3-Bromo-4-ethoxybenzoic acid has 3 hydrogen bond acceptor counts.