5-Amino-4-chloro-2-methylphenol

• Catalog Number: ACMA00001420
• Category: Amines
• Molecular Weight: 157.60
• Molecular Formula: C₇H₁₇N₃S
• Hazard Statements: H302-H318
• RIDADR: NONH for all modes of transport
• Symbol: GHS05

Custom Q&A

What is the molecular formula of 5-Amino-4-chloro-2-methylphenol?

The molecular formula is C7H8ClNO.

What is the molecular weight of 5-Amino-4-chloro-2-methylphenol?

The molecular weight is 157.60 g/mol.

What is the CAS number of 5-Amino-4-chloro-2-methylphenol?

The CAS number is 110102-86-8.

What is the InChI of 5-Amino-4-chloro-2-methylphenol?

The InChI is InChI=1S/C7H8ClNO/c1-4-2-5(8)6(9)3-7(4)10/h2-3,10H,9H2,1H3.

What is the InChIKey of 5-Amino-4-chloro-2-methylphenol?

The InChIKey is WDQMXRWYXILWPT-UHFFFAOYSA-N.

What is the IUPAC name of 5-Amino-4-chloro-2-methylphenol?

The IUPAC name is 5-amino-4-chloro-2-methylphenol.

What is the XLogP3-AA value of 5-Amino-4-chloro-2-methylphenol?

The XLogP3-AA value is 1.9.

How many hydrogen bond donor counts does 5-Amino-4-chloro-2-methylphenol have?

It has 2 hydrogen bond donor counts.

What is the topological polar surface area of 5-Amino-4-chloro-2-methylphenol?

The topological polar surface area is 46.2Ų.

Is 5-Amino-4-chloro-2-methylphenol a canonicalized compound?

Yes, it is a canonicalized compound.