2-Amino-3-hydroxybenzoic acid hydrochloride

• Catalog Number: ACMA00001418
• Category: Amines
• Molecular Weight: 189.60
• Molecular Formula: C₇H₁₈N₂
• Hazard Statements: H302-H318
• RIDADR: NONH for all modes of transport
• Symbol: GHS05

Custom Q&A

What is the PubChem CID of the compound 2-Amino-3-hydroxybenzoic acid hydrochloride?

PubChem CID 5743254

What is the molecular formula of 2-Amino-3-hydroxybenzoic acid hydrochloride?

C7H8ClNO3

What are some synonyms of 2-Amino-3-hydroxybenzoic acid hydrochloride?

4920-81-4, 3-Hydroxyanthranilic acid hydrochloride, 2-Amino-3-hydroxybenzoic Acid Hydrochloride, 3-Hydroxyanthranilic acid HCl

What is the molecular weight of 2-Amino-3-hydroxybenzoic acid hydrochloride?

189.59 g/mol

What is the IUPAC name of 2-Amino-3-hydroxybenzoic acid hydrochloride?

2-amino-3-hydroxybenzoic acid;hydrochloride

What is the InChIKey of 2-Amino-3-hydroxybenzoic acid hydrochloride?

WORPVBBWRKRSHQ-UHFFFAOYSA-N

What is the Canonical SMILES of 2-Amino-3-hydroxybenzoic acid hydrochloride?

C1=CC(=C(C(=C1)O)N)C(=O)O.Cl

How many hydrogen bond donor counts are there in 2-Amino-3-hydroxybenzoic acid hydrochloride?

4

What is the exact mass of 2-Amino-3-hydroxybenzoic acid hydrochloride?

189.0192708 g/mol

Is the compound 2-Amino-3-hydroxybenzoic acid hydrochloride canonicalized?

Yes