4-(N-Benzylaminocarbonyl)phenylboronic acid

• CAS: 252663-47-1
• Catalog Number: ACM252663471
• Category: Boronic Acids
• Molecular Weight: 255.08
• Molecular Formula: C₁₄H₁₄BNO₃

Custom Q&A

What is the molecular formula of 4-(N-Benzylaminocarbonyl)phenylboronic acid?

The molecular formula is C14H14BNO3.

What is the molecular weight of 4-(N-Benzylaminocarbonyl)phenylboronic acid?

The molecular weight is 255.08 g/mol.

What is the IUPAC name of 4-(N-Benzylaminocarbonyl)phenylboronic acid?

The IUPAC name is [4-(benzylcarbamoyl)phenyl]boronic acid.

What is the InChI of 4-(N-Benzylaminocarbonyl)phenylboronic acid?

The InChI is InChI=1S/C14H14BNO3/c17-14(16-10-11-4-2-1-3-5-11)12-6-8-13(9-7-12)15(18)19/h1-9,18-19H,10H2,(H,16,17).

What is the InChIKey of 4-(N-Benzylaminocarbonyl)phenylboronic acid?

The InChIKey is AAUCAVUVHBOOPF-UHFFFAOYSA-N.

What is the canonical SMILES of 4-(N-Benzylaminocarbonyl)phenylboronic acid?

The canonical SMILES is B(C1=CC=C(C=C1)C(=O)NCC2=CC=CC=C2)(O)O.

What is the CAS number of 4-(N-Benzylaminocarbonyl)phenylboronic acid?

The CAS number is 252663-47-1.

What is the EC number of 4-(N-Benzylaminocarbonyl)phenylboronic acid?

The EC number is 813-656-5.

What is the ChEMBL ID of 4-(N-Benzylaminocarbonyl)phenylboronic acid?

The ChEMBL ID is CHEMBL3770604.

Is 4-(N-Benzylaminocarbonyl)phenylboronic acid a canonicalized compound?

Yes, it is a canonicalized compound.