4-Bromo-2,5-bifluorophenylboronic acid

• CAS: 1106676-82-7
• Catalog Number: ACM1106676827
• Category: Boronic Acids

Custom Q&A

What is the molecular formula of 4-Bromo-2,5-bifluorophenylboronic acid?

The molecular formula of 4-Bromo-2,5-bifluorophenylboronic acid is C6H4BBrF2O2.

When was 4-Bromo-2,5-bifluorophenylboronic acid created?

4-Bromo-2,5-bifluorophenylboronic acid was created on December 5, 2007.

What is the IUPAC name of 4-Bromo-2,5-bifluorophenylboronic acid?

The IUPAC name of 4-Bromo-2,5-bifluorophenylboronic acid is (4-bromo-2,5-difluorophenyl)boronic acid.

What is the InChI of 4-Bromo-2,5-bifluorophenylboronic acid?

The InChI of 4-Bromo-2,5-bifluorophenylboronic acid is InChI=1S/C6H4BBrF2O2/c8-4-2-5(9)3(7(11)12)1-6(4)10/h1-2,11-12H.

What is the molecular weight of 4-Bromo-2,5-bifluorophenylboronic acid?

The molecular weight of 4-Bromo-2,5-bifluorophenylboronic acid is 236.81 g/mol.

What is the CAS number of 4-Bromo-2,5-bifluorophenylboronic acid?

The CAS number of 4-Bromo-2,5-bifluorophenylboronic acid is 1106676-82-7.

How many hydrogen bond donor counts does 4-Bromo-2,5-bifluorophenylboronic acid have?

4-Bromo-2,5-bifluorophenylboronic acid has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 4-Bromo-2,5-bifluorophenylboronic acid have?

4-Bromo-2,5-bifluorophenylboronic acid has 4 hydrogen bond acceptor counts.

How many rotatable bond counts does 4-Bromo-2,5-bifluorophenylboronic acid have?

4-Bromo-2,5-bifluorophenylboronic acid has 1 rotatable bond count.

Is 4-Bromo-2,5-bifluorophenylboronic acid a canonicalized compound?

Yes, 4-Bromo-2,5-bifluorophenylboronic acid is a canonicalized compound.