What is the molecular formula of 3,5-Dichloro-4-hydroxyphenylboronic acid?
The molecular formula is C6H5BCl2O3.
What are the synonyms of 3,5-Dichloro-4-hydroxyphenylboronic acid?
The synonyms include 1335048-35-5, (3,5-dichloro-4-hydroxyphenyl)boronic acid, and MFCD19105364.
What is the molecular weight of 3,5-Dichloro-4-hydroxyphenylboronic acid?
The molecular weight is 206.82 g/mol.
What is the IUPAC name of 3,5-Dichloro-4-hydroxyphenylboronic acid?
The IUPAC name is (3,5-dichloro-4-hydroxyphenyl)boronic acid.
What is the InChI of 3,5-Dichloro-4-hydroxyphenylboronic acid?
The InChI is InChI=1S/C6H5BCl2O3/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,10-12H.
What is the InChIKey of 3,5-Dichloro-4-hydroxyphenylboronic acid?
The InChIKey is PLWASSWLQMNNCS-UHFFFAOYSA-N.
What is the Canonical SMILES of 3,5-Dichloro-4-hydroxyphenylboronic acid?
The Canonical SMILES is B(C1=CC(=C(C(=C1)Cl)O)Cl)(O)O.
What is the hydrogen bond donor count of 3,5-Dichloro-4-hydroxyphenylboronic acid?
The hydrogen bond donor count is 3.
What is the hydrogen bond acceptor count of 3,5-Dichloro-4-hydroxyphenylboronic acid?
The hydrogen bond acceptor count is 3.
What is the topological polar surface area of 3,5-Dichloro-4-hydroxyphenylboronic acid?
The topological polar surface area is 60.7Ų.