--- Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 4-Methyl-2-ureido-pentanoic acid is C7H14N2O3.
The molecular weight of 4-Methyl-2-ureido-pentanoic acid is 174.20 g/mol.
The IUPAC name of 4-Methyl-2-ureido-pentanoic acid is 2-(carbamoylamino)-4-methylpentanoic acid.
The InChI of 4-Methyl-2-ureido-pentanoic acid is InChI=1S/C7H14N2O3/c1-4(2)3-5(6(10)11)9-7(8)12/h4-5H,3H2,1-2H3,(H,10,11)(H3,8,9,12).
The InChIKey of 4-Methyl-2-ureido-pentanoic acid is JUIBQJHHPDRAGP-UHFFFAOYSA-N.
The canonical SMILES of 4-Methyl-2-ureido-pentanoic acid is CC(C)CC(C(=O)O)NC(=O)N.
4-Methyl-2-ureido-pentanoic acid has 3 hydrogen bond donor counts.
4-Methyl-2-ureido-pentanoic acid has 3 hydrogen bond acceptor counts.
4-Methyl-2-ureido-pentanoic acid has 4 rotatable bond counts.
Yes, 4-Methyl-2-ureido-pentanoic acid is considered as a canonicalized compound.