What is the molecular formula of 4-Methoxy-3-(trifluoromethyl)bromobenzene?
The molecular formula is C8H6BrF3O.
When was 4-Methoxy-3-(trifluoromethyl)bromobenzene created and modified on PubChem?
It was created on July 19, 2005, and last modified on December 2, 2023.
What is the IUPAC name of 4-Methoxy-3-(trifluoromethyl)bromobenzene?
The IUPAC name is 4-bromo-1-methoxy-2-(trifluoromethyl)benzene.
What is the InChI code of 4-Methoxy-3-(trifluoromethyl)bromobenzene?
The InChI code is InChI=1S/C8H6BrF3O/c1-13-7-3-2-5(9)4-6(7)8(10,11)12/h2-4H,1H3.
What is the Canonical SMILES of 4-Methoxy-3-(trifluoromethyl)bromobenzene?
The Canonical SMILES is COC1=C(C=C(C=C1)Br)C(F)(F)F.
What is the molecular weight of 4-Methoxy-3-(trifluoromethyl)bromobenzene?
The molecular weight is 255.03 g/mol.
What is the XLogP3-AA value of 4-Methoxy-3-(trifluoromethyl)bromobenzene?
The XLogP3-AA value is 3.5.
How many hydrogen bond donor counts does 4-Methoxy-3-(trifluoromethyl)bromobenzene have?
It has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 4-Methoxy-3-(trifluoromethyl)bromobenzene have?
It has 4 hydrogen bond acceptor counts.
How many rotatable bond counts does 4-Methoxy-3-(trifluoromethyl)bromobenzene have?
It has 1 rotatable bond count.