3-(4-Bromobenzyl)-2-butyl-4-chloro-1H-imidazol-5-ylmethanol

• CAS: 151012-31-6
• Catalog Number: ACM151012316
• Category: Bromine Series
• Molecular Weight: 357.67
• Molecular Formula: C₁₅H₁₈BrClN₂O

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C15H20BrClN2O.

What are the synonyms of the compound?

The synonyms of the compound are (1-(4-bromobenzyl)-2-butyl-5-chloro-2,3-dihydro-1H-imidazol-4-yl)methanol and {1-[(4-bromophenyl)methyl]-2-butyl-5-chloro-2,3-dihydro-1H-imidazol-4-yl}methanol.

What is the molecular weight of the compound?

The molecular weight of the compound is 359.69 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is [3-[(4-bromophenyl)methyl]-2-butyl-4-chloro-1,2-dihydroimidazol-5-yl]methanol.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C15H20BrClN2O/c1-2-3-4-14-18-13(10-20)15(17)19(14)9-11-5-7-12(16)8-6-11/h5-8,14,18,20H,2-4,9-10H2,1H3.

What is the InChIKey of the compound?

The InChIKey of the compound is DYIJKOZDPIUEEU-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is CCCCC1NC(=C(N1CC2=CC=C(C=C2)Br)Cl)CO.

What is the CAS number of the compound?

The CAS number of the compound is 151012-31-6.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 4.5.

Is the compound canonicalized?

Yes, the compound is canonicalized.