(S)-(+)-2-Amino-4-bromobutyric acid hydrobromide

• CAS: 15159-65-6
• Catalog Number: ACM15159656
• Category: Bromine Series
• Molecular Weight: 262.93
• Molecular Formula: C₄H₈BrNO₂.HBr

Custom Q&A

What is the PubChem CID for (S)-(+)-2-Amino-4-bromobutyric acid hydrobromide?

PubChem CID 2733672

What is the molecular formula of (S)-(+)-2-Amino-4-bromobutyric acid hydrobromide?

The molecular formula is C4H9Br2NO2.

What is the molecular weight of (S)-(+)-2-Amino-4-bromobutyric acid hydrobromide?

The molecular weight is 262.93 g/mol.

What is the IUPAC name of (S)-(+)-2-Amino-4-bromobutyric acid hydrobromide?

The IUPAC name is (2S)-2-amino-4-bromobutanoic acid;hydrobromide.

What is the InChI of (S)-(+)-2-Amino-4-bromobutyric acid hydrobromide?

The InChI is InChI=1S/C4H8BrNO2.BrH/c5-2-1-3(6)4(7)8;/h3H,1-2,6H2,(H,7,8);1H/t3-;/m0./s1.

What is the Canonical SMILES of (S)-(+)-2-Amino-4-bromobutyric acid hydrobromide?

The Canonical SMILES is C(CBr)C(C(=O)O)N.Br.

What is the CAS number of (S)-(+)-2-Amino-4-bromobutyric acid hydrobromide?

The CAS number is 15159-65-6.

What is the hydrogen bond donor count of (S)-(+)-2-Amino-4-bromobutyric acid hydrobromide?

The hydrogen bond donor count is 3.

What is the hydrogen bond acceptor count of (S)-(+)-2-Amino-4-bromobutyric acid hydrobromide?

The hydrogen bond acceptor count is 3.

Is (S)-(+)-2-Amino-4-bromobutyric acid hydrobromide a canonical compound?

Yes, it is canonicalized.