4-Methoxy-3-(trifluoromethyl)benzaldehyde

• Catalog Number: ACMA00002964
• Category: Ethers
• Molecular Weight: 204.15
• Molecular Formula: C₉H₆O₄
• Hazard Statements: H318
• RIDADR: UN 2811 6.1 / PGIII
• Symbol: GHS05

Custom Q&A

What is the molecular formula of 4-Methoxy-3-(trifluoromethyl)benzaldehyde?

The molecular formula is C9H7F3O2.

What is the molecular weight of 4-Methoxy-3-(trifluoromethyl)benzaldehyde?

The molecular weight is 204.15 g/mol.

What is the IUPAC name of 4-Methoxy-3-(trifluoromethyl)benzaldehyde?

The IUPAC name is 4-methoxy-3-(trifluoromethyl)benzaldehyde.

What is the InChI of 4-Methoxy-3-(trifluoromethyl)benzaldehyde?

The InChI is InChI=1S/C9H7F3O2/c1-14-8-3-2-6(5-13)4-7(8)9(10,11)12/h2-5H,1H3.

What is the InChIKey of 4-Methoxy-3-(trifluoromethyl)benzaldehyde?

The InChIKey is UMZQFCFPWAFMRL-UHFFFAOYSA-N.

What is the canonical SMILES of 4-Methoxy-3-(trifluoromethyl)benzaldehyde?

The canonical SMILES is COC1=C(C=C(C=C1)C=O)C(F)(F)F.

What is the CAS number of 4-Methoxy-3-(trifluoromethyl)benzaldehyde?

The CAS number is 50823-87-5.

What is the European Community (EC) number of 4-Methoxy-3-(trifluoromethyl)benzaldehyde?

The EC number is 642-607-9.

What is the DSSTox Substance ID of 4-Methoxy-3-(trifluoromethyl)benzaldehyde?

The DSSTox Substance ID is DTXSID00379501.

Is 4-Methoxy-3-(trifluoromethyl)benzaldehyde considered a canonical compound?

Yes, it is considered a canonical compound.