2-Methoxy-4-(trifluoromethoxy)benzaldehyde

• Catalog Number: ACMA00002966
• Category: Ethers
• Molecular Weight: 220.15
• Molecular Formula: C₉H₇BrF₂O₂
• Hazard Statements: H301
• RIDADR: NONH for all modes of transport
• Symbol: GHS06

Custom Q&A

What is the molecular formula of 2-Methoxy-4-(trifluoromethoxy)benzaldehyde?

The molecular formula is C9H7F3O3.

What is the molecular weight of 2-Methoxy-4-(trifluoromethoxy)benzaldehyde?

The molecular weight is 220.14 g/mol.

What is the IUPAC name of 2-Methoxy-4-(trifluoromethoxy)benzaldehyde?

The IUPAC name is 2-methoxy-4-(trifluoromethoxy)benzaldehyde.

What is the InChI of 2-Methoxy-4-(trifluoromethoxy)benzaldehyde?

The InChI is InChI=1S/C9H7F3O3/c1-14-8-4-7(15-9(10,11)12)3-2-6(8)5-13/h2-5H,1H3.

What is the InChIKey of 2-Methoxy-4-(trifluoromethoxy)benzaldehyde?

The InChIKey is FHNKHGICKRDRLC-UHFFFAOYSA-N.

What is the Canonical SMILES of 2-Methoxy-4-(trifluoromethoxy)benzaldehyde?

The Canonical SMILES is COC1=C(C=CC(=C1)OC(F)(F)F)C=O.

What are the synonyms of 2-Methoxy-4-(trifluoromethoxy)benzaldehyde?

The synonyms are 886500-13-6 and 2-METHOXY-4-TRIFLUOROMETHOXYBENZALDEHYDE.

What is the XLogP3 value of 2-Methoxy-4-(trifluoromethoxy)benzaldehyde?

The XLogP3 value is 2.9.

How many hydrogen bond donor counts does 2-Methoxy-4-(trifluoromethoxy)benzaldehyde have?

It has 0 hydrogen bond donor count.

How many hydrogen bond acceptor counts does 2-Methoxy-4-(trifluoromethoxy)benzaldehyde have?

It has 6 hydrogen bond acceptor counts.