4-Methoxy-3-propoxybenzaldehyde

• Catalog Number: ACMA00002146
• Category: Ethers
• Molecular Weight: 194.23
• Molecular Formula: C₁₁H₁₃NO₄
• Hazard Statements: H319
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 4-Methoxy-3-propoxybenzaldehyde?

The molecular formula is C11H14O3.

What is the molecular weight of 4-Methoxy-3-propoxybenzaldehyde?

The molecular weight is 194.23 g/mol.

What is the IUPAC name of 4-Methoxy-3-propoxybenzaldehyde?

The IUPAC name is 4-methoxy-3-propoxybenzaldehyde.

What is the InChI of 4-Methoxy-3-propoxybenzaldehyde?

The InChI is InChI=1S/C11H14O3/c1-3-6-14-11-7-9(8-12)4-5-10(11)13-2/h4-5,7-8H,3,6H2,1-2H3.

What is the InChIKey of 4-Methoxy-3-propoxybenzaldehyde?

The InChIKey is OQGTYVGUCWWYNK-UHFFFAOYSA-N.

What is the canonical SMILES of 4-Methoxy-3-propoxybenzaldehyde?

The canonical SMILES is CCCOC1=C(C=CC(=C1)C=O)OC.

What is the XLogP3 value of 4-Methoxy-3-propoxybenzaldehyde?

The XLogP3 value is 2.2.

How many hydrogen bond donor counts does 4-Methoxy-3-propoxybenzaldehyde have?

It has 0 hydrogen bond donor count.

How many hydrogen bond acceptor counts does 4-Methoxy-3-propoxybenzaldehyde have?

It has 3 hydrogen bond acceptor counts.

How many rotatable bond counts does 4-Methoxy-3-propoxybenzaldehyde have?

It has 5 rotatable bond counts.