2-(2,3-Dimethylphenoxy)propanoic acid

• Catalog Number: ACMA00002147
• Category: Ethers
• Molecular Weight: 194.23
• Molecular Formula: C₁₁H₁₃NO₄
• Hazard Statements: H302-H411
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C11H14O3.

What are the synonyms of the compound?

Some synonyms of the compound are 2-(2,3-dimethylphenoxy)propanoic acid, 22504-84-3, Propanoic acid,2-(2,3-dimethylphenoxy)-, and 2-(2,3-Dimethyl-phenoxy)-propionic acid.

What is the molecular weight of the compound?

The molecular weight of the compound is 194.23 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 2-(2,3-dimethylphenoxy)propanoic acid.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C11H14O3/c1-7-5-4-6-10(8(7)2)14-9(3)11(12)13/h4-6,9H,1-3H3,(H,12,13).

What is the InChIKey of the compound?

The InChIKey of the compound is OMPCOTDSWVBJCH-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is CC1=C(C(=CC=C1)OC(C)C(=O)O)C.

What is the CAS number of the compound?

The CAS number of the compound is 22504-84-3.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 2.6.

Is the compound canonicalized?

Yes, the compound is canonicalized.