CAS
--- Purity
---
--- Purity
---
Shopping basket
4-Hydroxy-3-propylbenzoic acid methyl ester
Catalog Number
ACMA00002143
Category
Ethers
Molecular Weight
194.23
Molecular Formula
C11H14O2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H411
RIDADR
NONH for all modes of transport
Symbol
GHS09
What is the molecular formula of 4-Hydroxy-3-propylbenzoic acid methyl ester?
The molecular formula of 4-Hydroxy-3-propylbenzoic acid methyl ester is C11H14O3.
What are some synonyms for 4-Hydroxy-3-propylbenzoic acid methyl ester?
Some synonyms for 4-Hydroxy-3-propylbenzoic acid methyl ester are methyl 4-hydroxy-3-propylbenzoate and methyl 4-hydroxy-3-n-propylbenzoate.
What is the molecular weight of 4-Hydroxy-3-propylbenzoic acid methyl ester?
The molecular weight of 4-Hydroxy-3-propylbenzoic acid methyl ester is 194.23 g/mol.
What is the IUPAC name of 4-Hydroxy-3-propylbenzoic acid methyl ester?
The IUPAC name of 4-Hydroxy-3-propylbenzoic acid methyl ester is methyl 4-hydroxy-3-propylbenzoate.
What is the InChI of 4-Hydroxy-3-propylbenzoic acid methyl ester?
The InChI of 4-Hydroxy-3-propylbenzoic acid methyl ester is InChI=1S/C11H14O3/c1-3-4-8-7-9(11(13)14-2)5-6-10(8)12/h5-7,12H,3-4H2,1-2H3.
What is the InChIKey of 4-Hydroxy-3-propylbenzoic acid methyl ester?
The InChIKey of 4-Hydroxy-3-propylbenzoic acid methyl ester is BBGUEJVSGMTLIT-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Hydroxy-3-propylbenzoic acid methyl ester?
The canonical SMILES of 4-Hydroxy-3-propylbenzoic acid methyl ester is CCCC1=C(C=CC(=C1)C(=O)OC)O.
What is the CAS number of 4-Hydroxy-3-propylbenzoic acid methyl ester?
The CAS number of 4-Hydroxy-3-propylbenzoic acid methyl ester is 105211-78-7.
Is 4-Hydroxy-3-propylbenzoic acid methyl ester a canonicalized compound?
Yes, 4-Hydroxy-3-propylbenzoic acid methyl ester is a canonicalized compound.
Recommended Products
