CAS
874219-23-5 Purity
---
874219-23-5 Purity
---
Inquiry Basket
4-Fluoro-3-(piperidine-1-carbonyl)phenylboronic acid
CAS
874219-30-4
Catalog Number
ACM874219304-1
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 4-Fluoro-3-(piperidine-1-carbonyl)phenylboronic acid?
The molecular formula is C12H15BFNO3.
When was 4-Fluoro-3-(piperidine-1-carbonyl)phenylboronic acid created?
It was created on March 14, 2010.
What is the computed IUPAC name of 4-Fluoro-3-(piperidine-1-carbonyl)phenylboronic acid?
The computed IUPAC name is [4-fluoro-3-(piperidine-1-carbonyl)phenyl]boronic acid.
What is the Canonical SMILES of 4-Fluoro-3-(piperidine-1-carbonyl)phenylboronic acid?
The Canonical SMILES is B(C1=CC(=C(C=C1)F)C(=O)N2CCCCC2)(O)O.
What is the molecular weight of 4-Fluoro-3-(piperidine-1-carbonyl)phenylboronic acid?
The molecular weight is 251.06 g/mol.
How many hydrogen bond donor counts does 4-Fluoro-3-(piperidine-1-carbonyl)phenylboronic acid have?
It has 2 hydrogen bond donor counts.
What is the exact mass of 4-Fluoro-3-(piperidine-1-carbonyl)phenylboronic acid?
The exact mass is 251.1129017 g/mol.
How many heavy atoms are in 4-Fluoro-3-(piperidine-1-carbonyl)phenylboronic acid?
There are 18 heavy atoms.
Is the compound canonicalized?
Yes, the compound is canonicalized.
What is the topological polar surface area of 4-Fluoro-3-(piperidine-1-carbonyl)phenylboronic acid?
The topological polar surface area is 60.8 Ų.
Recommended Products
