CAS
874219-20-2 Purity
---
874219-20-2 Purity
---
Shopping basket
4-Fluoro-3-(dimethylcarbamoyl)phenylboronic acid
CAS
874219-27-9
Catalog Number
ACM874219279-1
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 4-Fluoro-3-(dimethylcarbamoyl)phenylboronic acid?
The molecular formula is C9H11BFNO3.
What is the molecular weight of 4-Fluoro-3-(dimethylcarbamoyl)phenylboronic acid?
The molecular weight is 211.00 g/mol.
What is the IUPAC name of 4-Fluoro-3-(dimethylcarbamoyl)phenylboronic acid?
The IUPAC name is [3-(dimethylcarbamoyl)-4-fluorophenyl]boronic acid.
What is the InChI of 4-Fluoro-3-(dimethylcarbamoyl)phenylboronic acid?
The InChI is InChI=1S/C9H11BFNO3/c1-12(2)9(13)7-5-6(10(14)15)3-4-8(7)11/h3-5,14-15H,1-2H3.
What is the InChIKey of 4-Fluoro-3-(dimethylcarbamoyl)phenylboronic acid?
The InChIKey is CRXFXVKQLCHKSK-UHFFFAOYSA-N.
What is the CAS number of 4-Fluoro-3-(dimethylcarbamoyl)phenylboronic acid?
The CAS number is 874219-27-9.
What is the European Community (EC) number of 4-Fluoro-3-(dimethylcarbamoyl)phenylboronic acid?
The European Community (EC) number is 691-344-6.
What is the monoisotopic mass of 4-Fluoro-3-(dimethylcarbamoyl)phenylboronic acid?
The monoisotopic mass is 211.0816015 g/mol.
How many hydrogen bond donor counts does 4-Fluoro-3-(dimethylcarbamoyl)phenylboronic acid have?
It has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 4-Fluoro-3-(dimethylcarbamoyl)phenylboronic acid have?
It has 4 hydrogen bond acceptor counts.
Recommended Products
