CAS
874219-30-4 Purity
---
874219-30-4 Purity
---
Inquiry Basket
3-Fluoro-5-(piperidine-1-carbonyl)phenylboronic acid
CAS
874219-43-9
Catalog Number
ACM874219439-1
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the PubChem CID of the compound 3-Fluoro-5-(piperidine-1-carbonyl)phenylboronic acid?
PubChem CID: 44717534
What is the molecular formula of 3-Fluoro-5-(piperidine-1-carbonyl)phenylboronic acid?
Molecular Formula: C12H15BFNO3
What are the synonyms of 3-Fluoro-5-(piperidine-1-carbonyl)phenylboronic acid?
Synonyms: 874219-43-9, (3-Fluoro-5-(piperidine-1-carbonyl)phenyl)boronic acid, [3-fluoro-5-(piperidine-1-carbonyl)phenyl]boronic acid, 3-Fluoro-5-(piperidin-1-ylcarbonyl)benzeneboronic acid
What is the molecular weight of 3-Fluoro-5-(piperidine-1-carbonyl)phenylboronic acid?
Molecular Weight: 251.06 g/mol
When was the compound created?
Created: 2010-03-14
When was the compound last modified?
Modified: 2023-12-02
What is the IUPAC name of 3-Fluoro-5-(piperidine-1-carbonyl)phenylboronic acid?
IUPAC Name: [3-fluoro-5-(piperidine-1-carbonyl)phenyl]boronic acid
What is the InChI of 3-Fluoro-5-(piperidine-1-carbonyl)phenylboronic acid?
InChI: InChI=1S/C12H15BFNO3/c14-11-7-9(6-10(8-11)13(17)18)12(16)15-4-2-1-3-5-15/h6-8,17-18H,1-5H2
What is the InChIKey of 3-Fluoro-5-(piperidine-1-carbonyl)phenylboronic acid?
InChIKey: NOYBFSLBXRVANN-UHFFFAOYSA-N
What is the canonical SMILES of 3-Fluoro-5-(piperidine-1-carbonyl)phenylboronic acid?
Canonical SMILES: B(C1=CC(=CC(=C1)F)C(=O)N2CCCCC2)(O)O
Recommended Products
