What is the molecular formula of 4-Ethyl-1,3-thiazol-2-amine hydrochloride hydrate?
The molecular formula is C5H11ClN2OS.
What is the molecular weight of 4-Ethyl-1,3-thiazol-2-amine hydrochloride hydrate?
The molecular weight is 182.67 g/mol.
What is the IUPAC name of 4-Ethyl-1,3-thiazol-2-amine hydrochloride hydrate?
The IUPAC name is 4-ethyl-1,3-thiazol-2-amine;hydrate;hydrochloride.
What is the InChI of 4-Ethyl-1,3-thiazol-2-amine hydrochloride hydrate?
The InChI is InChI=1S/C5H8N2S.ClH.H2O/c1-2-4-3-8-5(6)7-4;;/h3H,2H2,1H3,(H2,6,7);1H;1H2.
What is the InChIKey of 4-Ethyl-1,3-thiazol-2-amine hydrochloride hydrate?
The InChIKey is DHZAVXDWYZUKCD-UHFFFAOYSA-N.
What is the Canonical SMILES of 4-Ethyl-1,3-thiazol-2-amine hydrochloride hydrate?
The Canonical SMILES is CCC1=CSC(=N1)N.O.Cl.
How many hydrogen bond donor counts does 4-Ethyl-1,3-thiazol-2-amine hydrochloride hydrate have?
It has 3 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 4-Ethyl-1,3-thiazol-2-amine hydrochloride hydrate have?
It has 4 hydrogen bond acceptor counts.
How many rotatable bond counts does 4-Ethyl-1,3-thiazol-2-amine hydrochloride hydrate have?
It has 1 rotatable bond count.
What is the topological polar surface area of 4-Ethyl-1,3-thiazol-2-amine hydrochloride hydrate?
The topological polar surface area is 68.2Ų.