What is the molecular formula of 2-Methyl-1-propanamine hydrochloride?
The molecular formula is C4H12ClN.
What is the molecular weight of 2-Methyl-1-propanamine hydrochloride?
The molecular weight is 109.60 g/mol.
What is the IUPAC name of 2-Methyl-1-propanamine hydrochloride?
The IUPAC name is 2-methylpropylazanium;chloride.
What is the InChI of 2-Methyl-1-propanamine hydrochloride?
The InChI is InChI=1S/C4H11N.ClH/c1-4(2)3-5;/h4H,3,5H2,1-2H3;1H.
What is the InChIKey of 2-Methyl-1-propanamine hydrochloride?
The InChIKey is BSMNBEHEFWDHJD-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Methyl-1-propanamine hydrochloride?
The canonical SMILES is CC(C)C[NH3+].[Cl-].
What is the CAS number of 2-Methyl-1-propanamine hydrochloride?
The CAS number is 5041-09-8.
What is the hydrogen bond donor count of 2-Methyl-1-propanamine hydrochloride?
The hydrogen bond donor count is 1.
What is the hydrogen bond acceptor count of 2-Methyl-1-propanamine hydrochloride?
The hydrogen bond acceptor count is 1.
How many rotatable bonds are present in 2-Methyl-1-propanamine hydrochloride?
There is 1 rotatable bond present in 2-Methyl-1-propanamine hydrochloride.