4-Ethoxycarbonyl-2-nitrophenylboronic acid

• CAS: 5785-70-6
• Catalog Number: ACM5785706
• Category: Boronic Acids
• Molecular Weight: 238.99
• Molecular Formula: C9H10BNO6

Custom Q&A

What is the chemical name of the compound with PubChem CID 2773403?

The chemical name is (4-ethoxycarbonyl-2-nitrophenyl)boronic acid.

What is the molecular formula of the compound?

The molecular formula is C9H10BNO6.

What is the molecular weight of the compound?

The molecular weight is 238.99 g/mol.

What is the IUPAC Name of the compound?

The IUPAC Name is (4-ethoxycarbonyl-2-nitrophenyl)boronic acid.

What is the InChI of the compound?

The InChI is InChI=1S/C9H10BNO6/c1-2-17-9(12)6-3-4-7(10(13)14)8(5-6)11(15)16/h3-5,13-14H,2H2,1H3.

What is the InChIKey of the compound?

The InChIKey is GCDAYMSNTGTFDC-UHFFFAOYSA-N.

What is the Canonical SMILES of the compound?

The Canonical SMILES is B(C1=C(C=C(C=C1)C(=O)OCC)[N+](=O)[O-])(O)O.

What is the CAS number of the compound?

The CAS number is 5785-70-6.

What is the European Community (EC) Number of the compound?

The European Community (EC) Number is 690-782-5.

What is the ChEMBL ID of the compound?

The ChEMBL ID is CHEMBL91674.