3-Tert-butylphenylboronic acid

• CAS: 560132-24-3
• Catalog Number: ACM560132243
• Category: Boronic Acids
• Molecular Formula: C₁₀H₁₅BO₂

Custom Q&A

What is the molecular formula of 3-Tert-butylphenylboronic acid?

The molecular formula of 3-Tert-butylphenylboronic acid is C10H15BO2.

What is the molecular weight of 3-Tert-butylphenylboronic acid?

The molecular weight of 3-Tert-butylphenylboronic acid is 178.04 g/mol.

What is the IUPAC name of 3-Tert-butylphenylboronic acid?

The IUPAC name of 3-Tert-butylphenylboronic acid is (3-tert-butylphenyl)boronic acid.

What is the InChI of 3-Tert-butylphenylboronic acid?

The InChI of 3-Tert-butylphenylboronic acid is InChI=1S/C10H15BO2/c1-10(2,3)8-5-4-6-9(7-8)11(12)13/h4-7,12-13H,1-3H3.

What is the InChIKey of 3-Tert-butylphenylboronic acid?

The InChIKey of 3-Tert-butylphenylboronic acid is OKBOGYOXEDEGOG-UHFFFAOYSA-N.

What is the canonical SMILES of 3-Tert-butylphenylboronic acid?

The canonical SMILES of 3-Tert-butylphenylboronic acid is B(C1=CC(=CC=C1)C(C)(C)C)(O)O.

What is the CAS number of 3-Tert-butylphenylboronic acid?

The CAS number of 3-Tert-butylphenylboronic acid is 560132-24-3.

What is the European Community (EC) number of 3-Tert-butylphenylboronic acid?

The European Community (EC) number of 3-Tert-butylphenylboronic acid is 675-777-8.

How many hydrogen bond donor counts are there in 3-Tert-butylphenylboronic acid?

There are 2 hydrogen bond donor counts in 3-Tert-butylphenylboronic acid.

How many hydrogen bond acceptor counts are there in 3-Tert-butylphenylboronic acid?

There are 2 hydrogen bond acceptor counts in 3-Tert-butylphenylboronic acid.