CAS
5785-70-6 Purity
98%
5785-70-6 Purity
98%
Inquiry Basket
2-Chloro-4-(methoxymethoxy)phenylboronic acid
CAS
1135992-31-2
Catalog Number
ACM1135992312
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Chloro-4-(methoxymethoxy)phenylboronic acid?
The molecular formula of 2-Chloro-4-(methoxymethoxy)phenylboronic acid is C8H10BClO4.
When was 2-Chloro-4-(methoxymethoxy)phenylboronic acid created?
2-Chloro-4-(methoxymethoxy)phenylboronic acid was created on August 8, 2012.
What is the IUPAC name of 2-Chloro-4-(methoxymethoxy)phenylboronic acid?
The IUPAC name of 2-Chloro-4-(methoxymethoxy)phenylboronic acid is [2-chloro-4-(methoxymethoxy)phenyl]boronic acid.
What is the InChI of 2-Chloro-4-(methoxymethoxy)phenylboronic acid?
The InChI of 2-Chloro-4-(methoxymethoxy)phenylboronic acid is InChI=1S/C8H10BClO4/c1-13-5-14-6-2-3-7(9(11)12)8(10)4-6/h2-4,11-12H,5H2,1H3.
What is the InChIKey of 2-Chloro-4-(methoxymethoxy)phenylboronic acid?
The InChIKey of 2-Chloro-4-(methoxymethoxy)phenylboronic acid is PEGAMAHZAZSGFS-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Chloro-4-(methoxymethoxy)phenylboronic acid?
The canonical SMILES of 2-Chloro-4-(methoxymethoxy)phenylboronic acid is B(C1=C(C=C(C=C1)OCOC)Cl)(O)O.
What is the molecular weight of 2-Chloro-4-(methoxymethoxy)phenylboronic acid?
The molecular weight of 2-Chloro-4-(methoxymethoxy)phenylboronic acid is 216.43 g/mol.
How many hydrogen bond donor counts does 2-Chloro-4-(methoxymethoxy)phenylboronic acid have?
2-Chloro-4-(methoxymethoxy)phenylboronic acid has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2-Chloro-4-(methoxymethoxy)phenylboronic acid have?
2-Chloro-4-(methoxymethoxy)phenylboronic acid has 4 hydrogen bond acceptor counts.
How many rotatable bond counts does 2-Chloro-4-(methoxymethoxy)phenylboronic acid have?
2-Chloro-4-(methoxymethoxy)phenylboronic acid has 4 rotatable bond counts.
Recommended Products
