4-Chloro-3-(trifluoromethoxy)benzyl bromide

• Catalog Number: ACMA00002809
• Category: Ethers
• Molecular Weight: 289.48
• Molecular Formula: C₉H₂₀N₂O₂
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the chemical?

The molecular formula is C8H5BrClF3O.

What is the molecular weight of the chemical?

The molecular weight is 289.47 g/mol.

What is the IUPAC name of the chemical?

The IUPAC name is 4-(bromomethyl)-1-chloro-2-(trifluoromethoxy)benzene.

What is the InChI of the chemical?

The InChI is InChI=1S/C8H5BrClF3O/c9-4-5-1-2-6(10)7(3-5)14-8(11,12)13/h1-3H,4H2.

What is the InChIKey of the chemical?

The InChIKey is LAZINNAFCZCHLJ-UHFFFAOYSA-N.

What is the canonical SMILES of the chemical?

The canonical SMILES is C1=CC(=C(C=C1CBr)OC(F)(F)F)Cl.

What is the CAS number of the chemical?

The CAS number is 886500-93-2.

What is the EC number of the chemical?

The EC number is 679-355-4.

What is the hydrogen bond donor count of the chemical?

The hydrogen bond donor count is 0.

Is the compound canonicalized?

Yes, the compound is canonicalized.