CAS
--- Purity
---
--- Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula is C8H8F3NO.
The molecular weight is 191.15 g/mol.
The IUPAC name is 2-methyl-4-(trifluoromethoxy)aniline.
The Canonical SMILES representation is CC1=C(C=CC(=C1)OC(F)(F)F)N.
The CAS number is 86256-59-9.
The XLogP3 value is 2.4.
There is 1 hydrogen bond donor atom.
There are 5 hydrogen bond acceptor atoms.
There is 1 rotatable bond.
The topological polar surface area is 35.2Ų.