CAS
--- Purity
---
--- Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula is C8H5ClF2O2.
The molecular weight is 206.57 g/mol.
The IUPAC name is 2,6-difluoro-4-methoxybenzoyl chloride.
The canonical SMILES is COC1=CC(=C(C(=C1)F)C(=O)Cl)F.
The CAS number is 125369-56-4.
The XLogP3-AA value is 2.6.
There are 0 hydrogen bond donor counts.
There are 4 hydrogen bond acceptor counts.
There are 2 rotatable bond counts.
Yes, it is a canonicalized compound.