4-Benzyloxy-3,5-dichlorophenylboronic acid

• CAS: 1003298-85-8
• Catalog Number: ACM1003298858-1
• Category: Boronic Acids

Custom Q&A

What is the molecular formula of 4-Benzyloxy-3,5-dichlorophenylboronic acid?

The molecular formula is C13H11BCl2O3.

What are the synonyms of 4-Benzyloxy-3,5-dichlorophenylboronic acid?

Some synonyms include (4-(Benzyloxy)-3,5-dichlorophenylboronic acid and (3,5-dichloro-4-phenylmethoxyphenyl)boronic acid.

When was 4-Benzyloxy-3,5-dichlorophenylboronic acid created and modified?

It was created on 2005-09-13 and last modified on 2023-12-02.

What is the molecular weight of 4-Benzyloxy-3,5-dichlorophenylboronic acid?

The molecular weight is 296.9 g/mol.

What is the IUPAC name of 4-Benzyloxy-3,5-dichlorophenylboronic acid?

The IUPAC name is (3,5-dichloro-4-phenylmethoxyphenyl)boronic acid.

What is the Canonical SMILES of 4-Benzyloxy-3,5-dichlorophenylboronic acid?

The Canonical SMILES is B(C1=CC(=C(C(=C1)Cl)OCC2=CC=CC=C2)Cl)(O)O.

What is the InChIKey of 4-Benzyloxy-3,5-dichlorophenylboronic acid?

The InChIKey is BAXPPGSWZDNMOG-UHFFFAOYSA-N.

How many hydrogen bond donor counts does 4-Benzyloxy-3,5-dichlorophenylboronic acid have?

It has 2 hydrogen bond donor counts.

What is the heavy atom count of 4-Benzyloxy-3,5-dichlorophenylboronic acid?

The heavy atom count is 19.

Is 4-Benzyloxy-3,5-dichlorophenylboronic acid a covalently-bonded unit?

Yes, it is a covalently-bonded unit.