2-p-Terphenylboronic acid

• CAS: 663954-31-2
• Catalog Number: ACM663954312
• Category: Boronic Acids
• Molecular Formula: C₁₈H₁₅BO₂

Custom Q&A

What is the molecular formula of 2-p-Terphenylboronic acid?

The molecular formula of 2-p-Terphenylboronic acid is C18H15BO2.

What is the molecular weight of 2-p-Terphenylboronic acid?

The molecular weight of 2-p-Terphenylboronic acid is 274.1 g/mol.

What is the IUPAC name of 2-p-Terphenylboronic acid?

The IUPAC name of 2-p-Terphenylboronic acid is [2-(4-phenylphenyl)phenyl]boronic acid.

What is the InChI of 2-p-Terphenylboronic acid?

The InChI of 2-p-Terphenylboronic acid is InChI=1S/C18H15BO2/c20-19(21)18-9-5-4-8-17(18)16-12-10-15(11-13-16)14-6-2-1-3-7-14/h1-13,20-21H.

What is the InChIKey of 2-p-Terphenylboronic acid?

The InChIKey of 2-p-Terphenylboronic acid is SNYOIUKSBGFPSV-UHFFFAOYSA-N.

What is the canonical SMILES representation of 2-p-Terphenylboronic acid?

The canonical SMILES representation of 2-p-Terphenylboronic acid is B(C1=CC=CC=C1C2=CC=C(C=C2)C3=CC=CC=C3)(O)O.

What is the CAS number of 2-p-Terphenylboronic acid?

The CAS number of 2-p-Terphenylboronic acid is 663954-31-2.

What is the European Community (EC) number of 2-p-Terphenylboronic acid?

The European Community (EC) number of 2-p-Terphenylboronic acid is 672-647-2.

Is 2-p-Terphenylboronic acid a canonicalized compound?

Yes, 2-p-Terphenylboronic acid is a canonicalized compound.