2,3-Difluoro-6-benzyloxyphenylboronic acid

• CAS: 1451393-19-3
• Catalog Number: ACM1451393193
• Category: Boronic Acids

Custom Q&A

What is the molecular formula of 2,3-Difluoro-6-benzyloxyphenylboronic acid?

The molecular formula of 2,3-Difluoro-6-benzyloxyphenylboronic acid is C13H11BF2O3.

What is the molecular weight of 2,3-Difluoro-6-benzyloxyphenylboronic acid?

The molecular weight of 2,3-Difluoro-6-benzyloxyphenylboronic acid is 264.03 g/mol.

When was 2,3-Difluoro-6-benzyloxyphenylboronic acid created?

2,3-Difluoro-6-benzyloxyphenylboronic acid was created on January 26, 2010.

When was 2,3-Difluoro-6-benzyloxyphenylboronic acid last modified?

2,3-Difluoro-6-benzyloxyphenylboronic acid was last modified on December 2, 2023.

What is the IUPAC name of 2,3-Difluoro-6-benzyloxyphenylboronic acid?

The IUPAC name of 2,3-Difluoro-6-benzyloxyphenylboronic acid is (2,3-difluoro-6-phenylmethoxyphenyl)boronic acid.

What is the InChI of 2,3-Difluoro-6-benzyloxyphenylboronic acid?

The InChI of 2,3-Difluoro-6-benzyloxyphenylboronic acid is InChI=1S/C13H11BF2O3/c15-10-6-7-11(12(13(10)16)14(17)18)19-8-9-4-2-1-3-5-9/h1-7,17-18H,8H2.

What is the InChIKey of 2,3-Difluoro-6-benzyloxyphenylboronic acid?

The InChIKey of 2,3-Difluoro-6-benzyloxyphenylboronic acid is SLVNSQQTZBWDTP-UHFFFAOYSA-N.

What is the canonical SMILES of 2,3-Difluoro-6-benzyloxyphenylboronic acid?

The canonical SMILES of 2,3-Difluoro-6-benzyloxyphenylboronic acid is B(C1=C(C=CC(=C1F)F)OCC2=CC=CC=C2)(O)O.

How many hydrogen bond donor counts are there in 2,3-Difluoro-6-benzyloxyphenylboronic acid?

There are 2 hydrogen bond donor counts in 2,3-Difluoro-6-benzyloxyphenylboronic acid.

How many hydrogen bond acceptor counts are there in 2,3-Difluoro-6-benzyloxyphenylboronic acid?

There are 5 hydrogen bond acceptor counts in 2,3-Difluoro-6-benzyloxyphenylboronic acid.