4,6-Dimethyl-2-oxo-3,4-dihydro-2H-pyrido[1,2-a]pyrimidine-4-carboxylic acid

• Catalog Number: ACMA00000959
• Category: Amines
• Molecular Weight: 220.22
• Molecular Formula: C₁₁H₁₁NO₃
• Hazard Statements: H302-H318
• RIDADR: NONH for all modes of transport
• Symbol: GHS05

Custom Q&A

What is the molecular formula of 4,6-Dimethyl-2-oxo-3,4-dihydro-2H-pyrido[1,2-a]pyrimidine-4-carboxylic acid?

The molecular formula is C11H12N2O3.

What is the molecular weight of 4,6-Dimethyl-2-oxo-3,4-dihydro-2H-pyrido[1,2-a]pyrimidine-4-carboxylic acid?

The molecular weight is 220.22 g/mol.

What is the IUPAC name of the compound?

The IUPAC name is 4,6-dimethyl-2-oxo-3H-pyrido[1,2-a]pyrimidine-4-carboxylic acid.

What is the InChI of the compound?

The InChI is InChI=1S/C11H12N2O3/c1-7-4-3-5-8-12-9(14)6-11(2,10(15)16)13(7)8/h3-5H,6H2,1-2H3,(H,15,16).

What is the InChIKey of the compound?

The InChIKey is DITIYMYKXHWNFI-UHFFFAOYSA-N.

What is the Canonical SMILES of the compound?

The Canonical SMILES is CC1=CC=CC2=NC(=O)CC(N12)(C)C(=O)O.

What is the CAS number of the compound?

The CAS number is 956783-58-7.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value is 0.1.

How many hydrogen bond donor counts does the compound have?

The compound has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does the compound have?

The compound has 3 hydrogen bond acceptor counts.