2-Amino-5-(4-hydroxybenzyl)-4-methyl-1,3-thiazole

• Catalog Number: ACMA00000960
• Category: Amines
• Molecular Weight: 220.29
• Molecular Formula: C₁₁H₁₁NO₃
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound PubChem CID 672620?

The molecular formula is C11H12N2OS.

What is the molecular weight of PubChem CID 672620?

The molecular weight is 220.29 g/mol.

What is the IUPAC name of PubChem CID 672620?

The IUPAC name is 4-[(2-amino-4-methyl-1,3-thiazol-5-yl)methyl]phenol.

What is the InChI of PubChem CID 672620?

The InChI is InChI=1S/C11H12N2OS/c1-7-10(15-11(12)13-7)6-8-2-4-9(14)5-3-8/h2-5,14H,6H2,1H3,(H2,12,13).

What is the InChIKey of PubChem CID 672620?

The InChIKey is OYSGOQQALAMXRO-UHFFFAOYSA-N.

What is the canonical SMILES of PubChem CID 672620?

The canonical SMILES is CC1=C(SC(=N1)N)CC2=CC=C(C=C2)O.

What is the CAS number of PubChem CID 672620?

The CAS number is 309727-50-2.

How many hydrogen bond donor atoms does PubChem CID 672620 have?

PubChem CID 672620 has 2 hydrogen bond donor atoms.

How many hydrogen bond acceptor atoms does PubChem CID 672620 have?

PubChem CID 672620 has 4 hydrogen bond acceptor atoms.

How many rotatable bonds does PubChem CID 672620 have?

PubChem CID 672620 has 2 rotatable bonds.