3-N-Boc-3-(3,4-methylenedioxyphenyl)propionic acid

• Catalog Number: ACMA00002504
• Category: Ethers
• Molecular Weight: 309.31
• Molecular Formula: C₁₅H₁₆O₄
• Hazard Statements: H302
• RIDADR: UN 3077 9 / PGIII
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound?

The molecular formula is C15H19NO6.

What are the synonyms of the compound?

The synonyms are 149520-06-9, 3-(Benzo[d][1,3]dioxol-5-yl)-3-((tert-butoxycarbonyl)amino)propanoic acid, 3-(1,3-benzodioxol-5-yl)-3-[(tert-butoxycarbonyl)amino]propanoic acid, 3-(1,3-benzodioxol-5-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid, 3-Benzo[1,3]dioxol-5-yl-3-tert-butoxycarbonylamino-propionic acid.

What is the molecular weight of the compound?

The molecular weight is 309.31 g/mol.

What is the IUPAC name of the compound?

The IUPAC name is 3-(1,3-benzodioxol-5-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.

What is the InChI Key of the compound?

The InChI Key is UOQWIQGAZKFCDC-UHFFFAOYSA-N.

What is the Canonical SMILES of the compound?

The Canonical SMILES is CC(C)(C)OC(=O)NC(CC(=O)O)C1=CC2=C(C=C1)OCO2.

What is the CAS number of the compound?

The CAS number is 149520-06-9.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value is 1.8.

How many hydrogen bond donor counts does the compound have?

The compound has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does the compound have?

The compound has 6 hydrogen bond acceptor counts.