(R,S)-Boc-1-aminoindane-1-carboxylic acid

• Catalog Number: ACMA00002507
• Category: Ethers
• Molecular Weight: 277.32
• Molecular Formula: C₁₅H₁₆O₂
• Hazard Statements: H319
• RIDADR: UN 2811 6.1 / PGIII
• Symbol: GHS07

Custom Q&A

What is the molecular formula of (R,S)-Boc-1-aminoindane-1-carboxylic acid?

The molecular formula of (R,S)-Boc-1-aminoindane-1-carboxylic acid is C15H19NO4.

What is the molecular weight of (R,S)-Boc-1-aminoindane-1-carboxylic acid?

The molecular weight of (R,S)-Boc-1-aminoindane-1-carboxylic acid is 277.31 g/mol.

What is the IUPAC name of (R,S)-Boc-1-aminoindane-1-carboxylic acid?

The IUPAC name of (R,S)-Boc-1-aminoindane-1-carboxylic acid is 1-[(2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydroindene-1-carboxylic acid.

What is the InChI of (R,S)-Boc-1-aminoindane-1-carboxylic acid?

The InChI of (R,S)-Boc-1-aminoindane-1-carboxylic acid is InChI=1S/C15H19NO4/c1-14(2,3)20-13(19)16-15(12(17)18)9-8-10-6-4-5-7-11(10)15/h4-7H,8-9H2,1-3H3,(H,16,19)(H,17,18).

What is the InChIKey of (R,S)-Boc-1-aminoindane-1-carboxylic acid?

The InChIKey of (R,S)-Boc-1-aminoindane-1-carboxylic acid is UZCCJRDJRMVGLU-UHFFFAOYSA-N.

What is the canonical SMILES of (R,S)-Boc-1-aminoindane-1-carboxylic acid?

The canonical SMILES of (R,S)-Boc-1-aminoindane-1-carboxylic acid is CC(C)(C)OC(=O)NC1(CCC2=CC=CC=C21)C(=O)O.

What is the CAS number of (R,S)-Boc-1-aminoindane-1-carboxylic acid?

The CAS number of (R,S)-Boc-1-aminoindane-1-carboxylic acid is 214139-26-1.

What is the XLogP3-AA value of (R,S)-Boc-1-aminoindane-1-carboxylic acid?

The XLogP3-AA value of (R,S)-Boc-1-aminoindane-1-carboxylic acid is 2.4.

What is the hydrogen bond donor count of (R,S)-Boc-1-aminoindane-1-carboxylic acid?

The hydrogen bond donor count of (R,S)-Boc-1-aminoindane-1-carboxylic acid is 2.

What is the hydrogen bond acceptor count of (R,S)-Boc-1-aminoindane-1-carboxylic acid?

The hydrogen bond acceptor count of (R,S)-Boc-1-aminoindane-1-carboxylic acid is 4.