957121-15-2 Purity
98%
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is (3-methoxycarbonylphenyl)boronic acid.
The molecular formula of the compound is C8H9BO4.
The molecular weight of the compound is 179.97 g/mol.
The InChI of the compound is InChI=1S/C8H9BO4/c1-13-8(10)6-3-2-4-7(5-6)9(11)12/h2-5,11-12H,1H3.
The Canonical SMILES of the compound is B(C1=CC(=CC=C1)C(=O)OC)(O)O.
The CAS number of the compound is 99769-19-4.
The compound has 2 hydrogen bond donor counts.
The compound has 4 hydrogen bond acceptor counts.
The compound has 3 rotatable bond counts.
Yes, the compound is canonicalized.