CAS
1003845-06-4 Purity
---
1003845-06-4 Purity
---
Inquiry Basket
4-Formyl-2-methoxyphenylboronic acid
CAS
1028479-47-1
Catalog Number
ACM1028479471
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C8H9BO4.
What is the molecular weight of the compound?
The molecular weight of the compound is 179.97 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is (4-formyl-2-methoxyphenyl)boronic acid.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C8H9BO4/c1-13-8-4-6(5-10)2-3-7(8)9(11)12/h2-5,11-12H,1H3.
What is the InChIKey of the compound?
The InChIKey of the compound is PQECZCKVUFXDGP-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is B(C1=C(C=C(C=C1)C=O)OC)(O)O.
What is the CAS number of the compound?
The CAS number of the compound is 1028479-47-1.
What is the European Community (EC) number of the compound?
The European Community (EC) number of the compound is 814-299-8.
What is the DSSTox Substance ID of the compound?
The DSSTox Substance ID of the compound is DTXSID50726920.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
