CAS
99769-19-4 Purity
98%
99769-19-4 Purity
98%
Inquiry Basket
3-Cyano-4-fluorophenylboronic acid
CAS
241210-21-6
Catalog Number
ACM241210216
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 3-Cyano-4-fluorophenylboronic acid?
The molecular formula of 3-Cyano-4-fluorophenylboronic acid is C7H5BFNO2.
What is the molecular weight of 3-Cyano-4-fluorophenylboronic acid?
The molecular weight of 3-Cyano-4-fluorophenylboronic acid is 164.93 g/mol.
What is the IUPAC name of 3-Cyano-4-fluorophenylboronic acid?
The IUPAC name of 3-Cyano-4-fluorophenylboronic acid is (3-cyano-4-fluorophenyl)boronic acid.
What is the InChI of 3-Cyano-4-fluorophenylboronic acid?
The InChI of 3-Cyano-4-fluorophenylboronic acid is InChI=1S/C7H5BFNO2/c9-7-2-1-6(8(11)12)3-5(7)4-10/h1-3,11-12H.
What is the InChIKey of 3-Cyano-4-fluorophenylboronic acid?
The InChIKey of 3-Cyano-4-fluorophenylboronic acid is OLKIYJDSLMKNLC-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Cyano-4-fluorophenylboronic acid?
The canonical SMILES of 3-Cyano-4-fluorophenylboronic acid is B(C1=CC(=C(C=C1)F)C#N)(O)O.
What is the CAS number of 3-Cyano-4-fluorophenylboronic acid?
The CAS number of 3-Cyano-4-fluorophenylboronic acid is 214210-21-6.
How many hydrogen bond donor counts are there in 3-Cyano-4-fluorophenylboronic acid?
There are 2 hydrogen bond donor counts in 3-Cyano-4-fluorophenylboronic acid.
How many hydrogen bond acceptor counts are there in 3-Cyano-4-fluorophenylboronic acid?
There are 4 hydrogen bond acceptor counts in 3-Cyano-4-fluorophenylboronic acid.
Recommended Products
